from time import *from xlwt.Workbook import *from xlwt.Style import *style = XFStyle() wb = Workbook() ws0 = wb.add_sheet('0') colcount = 200 + 1rowcount = 6000 + 1t0 = time()print("\nstart: %s" % ctime(t0))print("Filling...")for col in xrange(colcount):print("[%d]" % col, end=' ') for row in xrange(rowcount): ws0.write(row, col, "BIG") t1 = time() - t0print("\nsince starting elapsed %.2f s" % (t1))print("Storing...") wb.save('big-16Mb.xls') t2 = time() - t0print("since starting elapsed %.2f s" % (t2))from xlwt import *font0 = Font() font0.name = 'Times New Roman'font0.struck_out = True font0.bold = True style0 = XFStyle() style0.font = font0 wb = Workbook() ws0 = wb.add_sheet('0') ws0.write(1, 1, 'Test', style0)for i in range(0, 0x53): borders = Borders() borders.left = i borders.right = i borders.top = i borders.bottom = i style = XFStyle() style.borders = borders ws0.write(i, 2, '', style) ws0.write(i, 3, hex(i), style0) ws0.write_merge(5, 8, 6, 10, "") wb.save('blanks.xls')from xlwt import *w = Workbook() ws = w.add_sheet('Hey, Dude')for i in range(6, 80): fnt = Font() fnt.height = i*20style = XFStyle() style.font = fnt ws.write(1, i, 'Test') ws.col(i).width = 0x0d00 + i w.save('col_width.xls')from xlwt import *from datetime import datetime w = Workbook() ws = w.add_sheet('Hey, Dude') fmts = ['M/D/YY','D-MMM-YY','D-MMM','MMM-YY','h:mm AM/PM','h:mm:ss AM/PM','h:mm','h:mm:ss','M/D/YY h:mm','mm:ss','[h]:mm:ss','mm:ss.0', ] i = 0for fmt in fmts: ws.write(i, 0, fmt) style = XFStyle() style.num_format_str = fmt ws.write(i, 4, datetime.now(), style) i += 1w.save('dates.xls')from xlwt import *font0 = Font() font0.name = 'Times New Roman'font0.struck_out = True font0.bold = True style0 = XFStyle() style0.font = font0 wb = Workbook() ws0 = wb.add_sheet('0') ws0.write(1, 1, 'Test', style0)for i in range(0, 0x53): fnt = Font() fnt.name = 'Arial'fnt.colour_index = i fnt.outline = True borders = Borders() borders.left = i style = XFStyle() style.font = fnt style.borders = borders ws0.write(i, 2, 'colour', style) ws0.write(i, 3, hex(i), style0) wb.save('format.xls')from xlwt import *w = Workbook() ws = w.add_sheet('F') ws.write(0, 0, Formula("-(1+1)")) ws.write(1, 0, Formula("-(1+1)/(-2-2)")) ws.write(2, 0, Formula("-(134.8780789+1)")) ws.write(3, 0, Formula("-(134.8780789e-10+1)")) ws.write(4, 0, Formula("-1/(1+1)+9344")) ws.write(0, 1, Formula("-(1+1)")) ws.write(1, 1, Formula("-(1+1)/(-2-2)")) ws.write(2, 1, Formula("-(134.8780789+1)")) ws.write(3, 1, Formula("-(134.8780789e-10+1)")) ws.write(4, 1, Formula("-1/(1+1)+9344")) ws.write(0, 2, Formula("A1*B1")) ws.write(1, 2, Formula("A2*B2")) ws.write(2, 2, Formula("A3*B3")) ws.write(3, 2, Formula("A4*B4*sin(pi()/4)")) ws.write(4, 2, Formula("A5%*B5*pi()/1000")) ws.write(5, 2, Formula("C1+C2+C3+C4+C5/(C1+C2+C3+C4/(C1+C2+C3+C4/(C1+C2+C3+C4)+C5)+C5)-20.3e-2")) ws.write(5, 3, Formula("C1^2")) ws.write(6, 2, Formula("SUM(C1;C2;;;;;C3;;;C4)")) ws.write(6, 3, Formula("SUM($A$1:$C$5)")) ws.write(7, 0, Formula('"lkjljllkllkl"')) ws.write(7, 1, Formula('"yuyiyiyiyi"')) ws.write(7, 2, Formula('A8 & B8 & A8')) ws.write(8, 2, Formula('now()')) ws.write(10, 2, Formula('TRUE')) ws.write(11, 2, Formula('FALSE')) ws.write(12, 3, Formula('IF(A1>A2;3;"hkjhjkhk")')) w.save('formulas.xls')from xlwt import *f = Font() f.height = 20*72f.name = 'Verdana'f.bold = True f.underline = Font.UNDERLINE_DOUBLE f.colour_index = 4h_style = XFStyle() h_style.font = f w = Workbook() ws = w.add_sheet('F') n = "HYPERLINK"ws.write_merge(1, 1, 1, 10, Formula(n + '("http://www.irs.gov/pub/irs-pdf/f1000.pdf";"f1000.pdf")'), h_style) ws.write_merge(2, 2, 2, 25, Formula(n + '("mailto:roman.kiseliov@gmail.com?subject=pyExcelerator-feedback&Body=Hello,%20Roman!";"pyExcelerator-feedback")'), h_style) w.save("hyperlinks.xls")from xlwt import *fnt = Font() fnt.name = 'Arial'fnt.colour_index = 4fnt.bold = True borders = Borders() borders.left = 6borders.right = 6borders.top = 6borders.bottom = 6al = Alignment() al.horz = Alignment.HORZ_CENTER al.vert = Alignment.VERT_CENTER style = XFStyle() style.font = fnt style.borders = borders style.alignment = al wb = Workbook() ws0 = wb.add_sheet('sheet0') ws1 = wb.add_sheet('sheet1') ws2 = wb.add_sheet('sheet2')for i in range(0, 0x200, 2): ws0.write_merge(i, i+1, 1, 5, 'test %d' % i, style) ws1.write_merge(i, i, 1, 7, 'test %d' % i, style) ws2.write_merge(i, i+1, 1, 7 + (i%10), 'test %d' % i, style) wb.save('merged.xls')import xlwt book = xlwt.Workbook()for magn in (0, 60, 100, 75, 150):for preview in (False, True): sheet = book.add_sheet('magn%d%s' % (magn, "np"[preview]))if preview: sheet.preview_magn = magnelse: sheet.normal_magn = magn sheet.page_preview = previewfor rowx in range(100): sheet.write(rowx, 0, "Some text") book.save("zoom_magnification.xls")import xlwtimport datetime ezxf = xlwt.easyxfdef write_xls(file_name, sheet_name, headings, data, heading_xf, data_xfs): book = xlwt.Workbook() sheet = book.add_sheet(sheet_name) rowx = 0for colx, value in enumerate(headings): sheet.write(rowx, colx, value, heading_xf) sheet.set_panes_frozen(True) # frozen headings instead of split panessheet.set_horz_split_pos(rowx+1) # in general, freeze after last heading rowsheet.set_remove_splits(True) # if user does unfreeze, don't leave a split therefor row in data: rowx += 1for colx, value in enumerate(row): sheet.write(rowx, colx, value, data_xfs[colx]) book.save(file_name)if __name__ == '__main__':import sys mkd = datetime.date hdngs = ['Date', 'Stock Code', 'Quantity', 'Unit Price', 'Value', 'Message'] kinds = 'date text int price money text'.split() data = [ [mkd(2007, 7, 1), 'ABC', 1000, 1.234567, 1234.57, ''], [mkd(2007, 12, 31), 'XYZ', -100, 4.654321, -465.43, 'Goods returned'], ] + [ [mkd(2008, 6, 30), 'PQRCD', 100, 2.345678, 234.57, ''], ] * 100heading_xf = ezxf('font: bold on; align: wrap on, vert centre, horiz center') kind_to_xf_map = {'date': ezxf(num_format_str='yyyy-mm-dd'),'int': ezxf(num_format_str='#,##0'),'money': ezxf('font: italic on; pattern: pattern solid, fore-colour grey25', num_format_str='$#,##0.00'),'price': ezxf(num_format_str='#0.000000'),'text': ezxf(), } data_xfs = [kind_to_xf_map[k] for k in kinds] write_xls('xlwt_easyxf_simple_demo.xls', 'Demo', hdngs, data, heading_xf, data_xfs)from xlwt import *w = Workbook() ws = w.add_sheet('Hey, Dude')for i in range(6, 80): fnt = Font() fnt.height = i*20style = XFStyle() style.font = fnt ws.write(i, 1, 'Test') ws.row(i).set_style(style) w.save('row_styles.xls')from xlwt import *fnt = Font() fnt.name = 'Arial'fnt.colour_index = 4fnt.bold = True borders = Borders() borders.left = 6borders.right = 6borders.top = 6borders.bottom = 6style = XFStyle() style.font = fnt style.borders = borders wb = Workbook() ws0 = wb.add_sheet('Rows Outline') ws0.write_merge(1, 1, 1, 5, 'test 1', style) ws0.write_merge(2, 2, 1, 4, 'test 1', style) ws0.write_merge(3, 3, 1, 3, 'test 2', style) ws0.write_merge(4, 4, 1, 4, 'test 1', style) ws0.write_merge(5, 5, 1, 4, 'test 3', style) ws0.write_merge(6, 6, 1, 5, 'test 1', style) ws0.write_merge(7, 7, 1, 5, 'test 4', style) ws0.write_merge(8, 8, 1, 4, 'test 1', style) ws0.write_merge(9, 9, 1, 3, 'test 5', style) ws0.row(1).level = 1ws0.row(2).level = 1ws0.row(3).level = 2ws0.row(4).level = 2ws0.row(5).level = 2ws0.row(6).level = 2ws0.row(7).level = 2ws0.row(8).level = 1ws0.row(9).level = 1ws1 = wb.add_sheet('Columns Outline') ws1.write_merge(1, 1, 1, 5, 'test 1', style) ws1.write_merge(2, 2, 1, 4, 'test 1', style) ws1.write_merge(3, 3, 1, 3, 'test 2', style) ws1.write_merge(4, 4, 1, 4, 'test 1', style) ws1.write_merge(5, 5, 1, 4, 'test 3', style) ws1.write_merge(6, 6, 1, 5, 'test 1', style) ws1.write_merge(7, 7, 1, 5, 'test 4', style) ws1.write_merge(8, 8, 1, 4, 'test 1', style) ws1.write_merge(9, 9, 1, 3, 'test 5', style) ws1.col(1).level = 1ws1.col(2).level = 1ws1.col(3).level = 2ws1.col(4).level = 2ws1.col(5).level = 2ws1.col(6).level = 2ws1.col(7).level = 2ws1.col(8).level = 1ws1.col(9).level = 1ws2 = wb.add_sheet('Rows and Columns Outline') ws2.write_merge(1, 1, 1, 5, 'test 1', style) ws2.write_merge(2, 2, 1, 4, 'test 1', style) ws2.write_merge(3, 3, 1, 3, 'test 2', style) ws2.write_merge(4, 4, 1, 4, 'test 1', style) ws2.write_merge(5, 5, 1, 4, 'test 3', style) ws2.write_merge(6, 6, 1, 5, 'test 1', style) ws2.write_merge(7, 7, 1, 5, 'test 4', style) ws2.write_merge(8, 8, 1, 4, 'test 1', style) ws2.write_merge(9, 9, 1, 3, 'test 5', style) ws2.row(1).level = 1ws2.row(2).level = 1ws2.row(3).level = 2ws2.row(4).level = 2ws2.row(5).level = 2ws2.row(6).level = 2ws2.row(7).level = 2ws2.row(8).level = 1ws2.row(9).level = 1ws2.col(1).level = 1ws2.col(2).level = 1ws2.col(3).level = 2ws2.col(4).level = 2ws2.col(5).level = 2ws2.col(6).level = 2ws2.col(7).level = 2ws2.col(8).level = 1ws2.col(9).level = 1ws0.protect = True ws0.wnd_protect = True ws0.obj_protect = True ws0.scen_protect = True ws0.password = "123456"ws1.protect = True ws1.wnd_protect = True ws1.obj_protect = True ws1.scen_protect = True ws1.password = "abcdefghij"ws2.protect = True ws2.wnd_protect = True ws2.obj_protect = True ws2.scen_protect = True ws2.password = "ok"wb.protect = True wb.wnd_protect = True wb.obj_protect = True wb.save('protection.xls')from xlwt import Workbookfrom xlwt.BIFFRecords import PanesRecord w = Workbook()# do each of the 4 scenarios with each of the 4 possible# active pane settingsfor px,py in ( (0,0), # no split(0,10), # horizontal split(10,0), # vertical split(10,10), # both split ): for active in range(4):# 0 - logical bottom-right pane# 1 - logical top-right pane# 2 - logical bottom-left pane# 3 - logical top-left pane# only set valid values:if active not in PanesRecord.valid_active_pane.get( (int(px > 0),int(py > 0)) ):continuesheet = w.add_sheet('px-%i py-%i active-%i' %( px,py,active ))for rx in range(20):for cx in range(20): sheet.write(rx,cx,'R%iC%i'%(rx,cx)) sheet.panes_frozen = False sheet.vert_split_pos = px * 8.43sheet.horz_split_pos = py * 12.75sheet.active_pane = active w.save('panes3.xls')import xlwt w = xlwt.Workbook() sheets = [w.add_sheet('sheet ' + str(sheetx+1)) for sheetx in range(7)] ws1, ws2, ws3, ws4, ws5, ws6, ws7 = sheetsfor sheet in sheets:for i in range(0x100): sheet.write(i // 0x10, i % 0x10, i) H = 1V = 2HF = H + 2VF = V + 2ws1.panes_frozen = True ws1.horz_split_pos = H ws1.horz_split_first_visible = HF ws2.panes_frozen = True ws2.vert_split_pos = V ws2.vert_split_first_visible = VF ws3.panes_frozen = True ws3.horz_split_pos = H ws3.vert_split_pos = V ws3.horz_split_first_visible = HF ws3.vert_split_first_visible = VF H = 10V = 12HF = H + 2VF = V + 2ws4.panes_frozen = False ws4.horz_split_pos = H * 12.75 # rowsws4.horz_split_first_visible = HF ws5.panes_frozen = False ws5.vert_split_pos = V * 8.43 # rowsws5.vert_split_first_visible = VF ws6.panes_frozen = False ws6.horz_split_pos = H * 12.75 # rowsws6.horz_split_first_visible = HF ws6.vert_split_pos = V * 8.43 # colsws6.vert_split_first_visible = VF ws7.split_position_units_are_twips = True ws7.panes_frozen = False ws7.horz_split_pos = H * 250 + 240 # twipsws7.horz_split_first_visible = HF ws7.vert_split_pos = V * 955 + 410 # twipsws7.vert_split_first_visible = VF w.save('panes2.xls')from xlwt import *wb = Workbook() ws0 = wb.add_sheet('sheet0') fnt1 = Font() fnt1.name = 'Verdana'fnt1.bold = True fnt1.height = 18*0x14pat1 = Pattern() pat1.pattern = Pattern.SOLID_PATTERN pat1.pattern_fore_colour = 0x16brd1 = Borders() brd1.left = 0x06brd1.right = 0x06brd1.top = 0x06brd1.bottom = 0x06fnt2 = Font() fnt2.name = 'Verdana'fnt2.bold = True fnt2.height = 14*0x14brd2 = Borders() brd2.left = 0x01brd2.right = 0x01brd2.top = 0x01brd2.bottom = 0x01pat2 = Pattern() pat2.pattern = Pattern.SOLID_PATTERN pat2.pattern_fore_colour = 0x01Ffnt3 = Font() fnt3.name = 'Verdana'fnt3.bold = True fnt3.italic = True fnt3.height = 12*0x14brd3 = Borders() brd3.left = 0x07brd3.right = 0x07brd3.top = 0x07brd3.bottom = 0x07fnt4 = Font() al1 = Alignment() al1.horz = Alignment.HORZ_CENTER al1.vert = Alignment.VERT_CENTER al2 = Alignment() al2.horz = Alignment.HORZ_RIGHT al2.vert = Alignment.VERT_CENTER al3 = Alignment() al3.horz = Alignment.HORZ_LEFT al3.vert = Alignment.VERT_CENTER style1 = XFStyle() style1.font = fnt1 style1.alignment = al1 style1.pattern = pat1 style1.borders = brd1 style2 = XFStyle() style2.font = fnt2 style2.alignment = al1 style2.pattern = pat2 style2.borders = brd2 style3 = XFStyle() style3.font = fnt3 style3.alignment = al1 style3.pattern = pat2 style3.borders = brd3 price_style = XFStyle() price_style.font = fnt4 price_style.alignment = al2 price_style.borders = brd3 price_style.num_format_str = '_(#,##0.00_) "money"'ware_style = XFStyle() ware_style.font = fnt4 ware_style.alignment = al3 ware_style.borders = brd3 ws0.merge(3, 3, 1, 5, style1) ws0.merge(4, 10, 1, 6, style2) ws0.merge(14, 16, 1, 7, style3) ws0.col(1).width = 0x0d00wb.save('merged1.xls')from xlwt import *w = Workbook() ws = w.add_sheet('Hey, Dude') fmts = ['general','0','0.00','#,##0','#,##0.00','"$"#,##0_);("$"#,##','"$"#,##0_);[Red]("$"#,##','"$"#,##0.00_);("$"#,##','"$"#,##0.00_);[Red]("$"#,##','0%','0.00%','0.00E+00','# ?/?','# ??/??','M/D/YY','D-MMM-YY','D-MMM','MMM-YY','h:mm AM/PM','h:mm:ss AM/PM','h:mm','h:mm:ss','M/D/YY h:mm','_(#,##0_);(#,##0)','_(#,##0_);[Red](#,##0)','_(#,##0.00_);(#,##0.00)','_(#,##0.00_);[Red](#,##0.00)','_("$"* #,##0_);_("$"* (#,##0);_("$"* "-"_);_(@_)','_(* #,##0_);_(* (#,##0);_(* "-"_);_(@_)','_("$"* #,##0.00_);_("$"* (#,##0.00);_("$"* "-"??_);_(@_)','_(* #,##0.00_);_(* (#,##0.00);_(* "-"??_);_(@_)','mm:ss','[h]:mm:ss','mm:ss.0','##0.0E+0','@' ] i = 0for fmt in fmts: ws.write(i, 0, fmt) style = XFStyle() style.num_format_str = fmt ws.write(i, 4, -1278.9078, style) i += 1w.save('num_formats.xls')
The above is the detailed content of Example display on xlwt official website. For more information, please follow other related articles on the PHP Chinese website!

This article explains how to use Beautiful Soup, a Python library, to parse HTML. It details common methods like find(), find_all(), select(), and get_text() for data extraction, handling of diverse HTML structures and errors, and alternatives (Sel

Python's statistics module provides powerful data statistical analysis capabilities to help us quickly understand the overall characteristics of data, such as biostatistics and business analysis. Instead of looking at data points one by one, just look at statistics such as mean or variance to discover trends and features in the original data that may be ignored, and compare large datasets more easily and effectively. This tutorial will explain how to calculate the mean and measure the degree of dispersion of the dataset. Unless otherwise stated, all functions in this module support the calculation of the mean() function instead of simply summing the average. Floating point numbers can also be used. import random import statistics from fracti

This article compares TensorFlow and PyTorch for deep learning. It details the steps involved: data preparation, model building, training, evaluation, and deployment. Key differences between the frameworks, particularly regarding computational grap

Serialization and deserialization of Python objects are key aspects of any non-trivial program. If you save something to a Python file, you do object serialization and deserialization if you read the configuration file, or if you respond to an HTTP request. In a sense, serialization and deserialization are the most boring things in the world. Who cares about all these formats and protocols? You want to persist or stream some Python objects and retrieve them in full at a later time. This is a great way to see the world on a conceptual level. However, on a practical level, the serialization scheme, format or protocol you choose may determine the speed, security, freedom of maintenance status, and other aspects of the program

The article discusses popular Python libraries like NumPy, Pandas, Matplotlib, Scikit-learn, TensorFlow, Django, Flask, and Requests, detailing their uses in scientific computing, data analysis, visualization, machine learning, web development, and H

This article guides Python developers on building command-line interfaces (CLIs). It details using libraries like typer, click, and argparse, emphasizing input/output handling, and promoting user-friendly design patterns for improved CLI usability.

This tutorial builds upon the previous introduction to Beautiful Soup, focusing on DOM manipulation beyond simple tree navigation. We'll explore efficient search methods and techniques for modifying HTML structure. One common DOM search method is ex

The article discusses the role of virtual environments in Python, focusing on managing project dependencies and avoiding conflicts. It details their creation, activation, and benefits in improving project management and reducing dependency issues.


Hot AI Tools

Undresser.AI Undress
AI-powered app for creating realistic nude photos

AI Clothes Remover
Online AI tool for removing clothes from photos.

Undress AI Tool
Undress images for free

Clothoff.io
AI clothes remover

AI Hentai Generator
Generate AI Hentai for free.

Hot Article

Hot Tools

EditPlus Chinese cracked version
Small size, syntax highlighting, does not support code prompt function

Dreamweaver CS6
Visual web development tools

WebStorm Mac version
Useful JavaScript development tools

SublimeText3 Mac version
God-level code editing software (SublimeText3)

DVWA
Damn Vulnerable Web App (DVWA) is a PHP/MySQL web application that is very vulnerable. Its main goals are to be an aid for security professionals to test their skills and tools in a legal environment, to help web developers better understand the process of securing web applications, and to help teachers/students teach/learn in a classroom environment Web application security. The goal of DVWA is to practice some of the most common web vulnerabilities through a simple and straightforward interface, with varying degrees of difficulty. Please note that this software
